|
CAS#: 63302-98-7 Product: Tris[(1-Methyl-1-Phenylethyl)Phenyl] Phosphate No suppilers available for the product. |
| Name | Tris[(1-Methyl-1-Phenylethyl)Phenyl] Phosphate |
|---|---|
| Synonyms | [2-(1-Methyl-1-Phenyl-Ethyl)Phenyl] Dihydrogen Phosphate; [2-(1-Methyl-1-Phenylethyl)Phenyl] Dihydrogen Phosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C15H17O4P |
| Molecular Weight | 292.27 |
| CAS Registry Number | 63302-98-7 |
| EINECS | 264-088-4 |
| SMILES | C1=C(C(=CC=C1)O[P](=O)(O)O)C(C)(C2=CC=CC=C2)C |
| InChI | 1S/C15H17O4P/c1-15(2,12-8-4-3-5-9-12)13-10-6-7-11-14(13)19-20(16,17)18/h3-11H,1-2H3,(H2,16,17,18) |
| InChIKey | IPMOLHAIDJEBQN-UHFFFAOYSA-N |
| Density | 1.274g/cm3 (Cal.) |
|---|---|
| Boiling point | 460.581°C at 760 mmHg (Cal.) |
| Flash point | 232.351°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tris[(1-Methyl-1-Phenylethyl)Phenyl] Phosphate |