|
CAS#: 63347-65-9 Product: Technetium-99 hydroxyethylidenediphosphonate No suppilers available for the product. |
| Name | Technetium-99 hydroxyethylidenediphosphonate |
|---|---|
| Synonyms | (1-Hydroxy-1-Phosphono-Ethyl)Phosphonic Acid; Technetium; Moli000623; Phosphonic Acid, (1-Hydroxyethylidene)Bis-, Technetium-(99)Tc Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C2H8O7P2Tc |
| Molecular Weight | 304.93 |
| CAS Registry Number | 63347-65-9 |
| SMILES | [99Tc].CC([P](=O)(O)O)([P](=O)(O)O)O |
| InChI | 1S/C2H8O7P2.Tc/c1-2(3,10(4,5)6)11(7,8)9;/h3H,1H3,(H2,4,5,6)(H2,7,8,9);/i;1+1 |
| InChIKey | VEXMHRQGHKTMHQ-IEOVAKBOSA-N |
| Boiling point | 578.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 303.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Technetium-99 hydroxyethylidenediphosphonate |