|
CAS#: 6338-09-6 Product: 1-Mercaptoanthraquinone No suppilers available for the product. |
| Name | 1-Mercaptoanthraquinone |
|---|---|
| Synonyms | 1-Mercaptoanthracene-9,10-Dione; 1-Mercapto-9,10-Anthraquinone; Aids124541 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H8O2S |
| Molecular Weight | 240.28 |
| CAS Registry Number | 6338-09-6 |
| SMILES | C1=CC=C(C2=C1C(C3=C(C2=O)C=CC=C3)=O)S |
| InChI | 1S/C14H8O2S/c15-13-8-4-1-2-5-9(8)14(16)12-10(13)6-3-7-11(12)17/h1-7,17H |
| InChIKey | YHCIQYSVFONICB-UHFFFAOYSA-N |
| Density | 1.4g/cm3 (Cal.) |
|---|---|
| Boiling point | 451.81°C at 760 mmHg (Cal.) |
| Flash point | 227.047°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Mercaptoanthraquinone |