|
CAS#: 634151-20-5 Product: 1-(2,5-Dimethylphenyl)-5-thioxo-2-pyrrolidinone No suppilers available for the product. |
| Name | 1-(2,5-Dimethylphenyl)-5-thioxo-2-pyrrolidinone |
|---|---|
| Synonyms | 1-(2,5-dimethylphenyl)-5-thioxopyrrolidin-2-one |
| Molecular Structure | ![]() |
| Molecular Formula | C12H13NOS |
| Molecular Weight | 219.30 |
| CAS Registry Number | 634151-20-5 |
| SMILES | O=C2N(c1c(ccc(c1)C)C)C(=S)CC2 |
| InChI | 1S/C12H13NOS/c1-8-3-4-9(2)10(7-8)13-11(14)5-6-12(13)15/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | YUQKWMGNPYHDLH-UHFFFAOYSA-N |
| Density | 1.233g/cm3 (Cal.) |
|---|---|
| Boiling point | 345.919°C at 760 mmHg (Cal.) |
| Flash point | 163.006°C (Cal.) |
| Refractive index | 1.634 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2,5-Dimethylphenyl)-5-thioxo-2-pyrrolidinone |