|
CAS#: 63468-75-7 Product: Sodium 3-(O-Nitrophenyl)Pyruvate No suppilers available for the product. |
| Name | Sodium 3-(O-Nitrophenyl)Pyruvate |
|---|---|
| Synonyms | Sodium 3-(2-Nitrophenyl)-2-Oxo-Propanoate; Sodium 2-Keto-3-(2-Nitrophenyl)Propionate |
| Molecular Structure | ![]() |
| Molecular Formula | C9H6NNaO5 |
| Molecular Weight | 231.14 |
| CAS Registry Number | 63468-75-7 |
| EINECS | 264-256-7 |
| SMILES | C1=CC=CC(=C1CC(=O)C([O-])=O)[N+]([O-])=O.[Na+] |
| InChI | 1S/C9H7NO5.Na/c11-8(9(12)13)5-6-3-1-2-4-7(6)10(14)15;/h1-4H,5H2,(H,12,13);/q;+1/p-1 |
| InChIKey | MJWPDORYZRKZTE-UHFFFAOYSA-M |
| Boiling point | 379.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 168.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sodium 3-(O-Nitrophenyl)Pyruvate |