|
CAS#: 63472-04-8 Product: Metbufen No suppilers available for the product. |
| Name | Metbufen |
|---|---|
| Synonyms | 4-Keto-2-Methyl-4-(4-Phenylphenyl)Butyric Acid; 3-(4-Biphenylylcarbonyl)-2-Methylpropionic Acid; 3-(4-Biphenylylcarbonyl)-2-Methylpropionsaeure |
| Molecular Structure | ![]() |
| Molecular Formula | C17H16O3 |
| Molecular Weight | 268.31 |
| CAS Registry Number | 63472-04-8 |
| SMILES | C1=CC(=CC=C1C2=CC=CC=C2)C(CC(C(O)=O)C)=O |
| InChI | 1S/C17H16O3/c1-12(17(19)20)11-16(18)15-9-7-14(8-10-15)13-5-3-2-4-6-13/h2-10,12H,11H2,1H3,(H,19,20) |
| InChIKey | FDRDUFLWFSLNFT-UHFFFAOYSA-N |
| Density | 1.163g/cm3 (Cal.) |
|---|---|
| Boiling point | 471.629°C at 760 mmHg (Cal.) |
| Flash point | 253.146°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Metbufen |