|
CAS#: 63610-06-0 Product: 3,4-Dihydro-1,3-Dimethyl-4-[(Phenylazo)Methyl]-2(1H)-Pyrimidinone No suppilers available for the product. |
| Name | 3,4-Dihydro-1,3-Dimethyl-4-[(Phenylazo)Methyl]-2(1H)-Pyrimidinone |
|---|---|
| Synonyms | 1,3-Dimethyl-4-(Phenylazomethyl)-4H-Pyrimidin-2-One; 2(1H)-Pyrimidinone, 3,4-Dihydro-1,3-Dimethyl-4-((Phenylazo)Methyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 |
| CAS Registry Number | 63610-06-0 |
| SMILES | C1=CC=C(C=C1)N=NCC2N(C(=O)N(C)C=C2)C |
| InChI | 1S/C13H16N4O/c1-16-9-8-12(17(2)13(16)18)10-14-15-11-6-4-3-5-7-11/h3-9,12H,10H2,1-2H3 |
| InChIKey | HCANMDYPWIVMMB-UHFFFAOYSA-N |
| Density | 1.155g/cm3 (Cal.) |
|---|---|
| Boiling point | 363.805°C at 760 mmHg (Cal.) |
| Flash point | 173.823°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4-Dihydro-1,3-Dimethyl-4-[(Phenylazo)Methyl]-2(1H)-Pyrimidinone |