|
CAS#: 63717-02-2 Product: 3-Propylquinazoline-4(3H)-Thione No suppilers available for the product. |
| Name | 3-Propylquinazoline-4(3H)-Thione |
|---|---|
| Synonyms | 3-Propyl-4-Quinazolinethione; 4(3H)-Quinazolinethione, 3-Propyl-; 3-Propyl-4-(3H)-Quinazolinethione |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12N2S |
| Molecular Weight | 204.29 |
| CAS Registry Number | 63717-02-2 |
| SMILES | C1=CC=CC2=C1C(N(C=N2)CCC)=S |
| InChI | 1S/C11H12N2S/c1-2-7-13-8-12-10-6-4-3-5-9(10)11(13)14/h3-6,8H,2,7H2,1H3 |
| InChIKey | UXSVFLJNNWQYJC-UHFFFAOYSA-N |
| Density | 1.161g/cm3 (Cal.) |
|---|---|
| Boiling point | 330.468°C at 760 mmHg (Cal.) |
| Flash point | 153.662°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Propylquinazoline-4(3H)-Thione |