|
CAS#: 63755-05-5 Product: Chlobenthiazone No suppilers available for the product. |
| Name | Chlobenthiazone |
|---|---|
| Synonyms | 2(3H)-Benzothiazolone, 4-Chloro-3-Methyl-; 4-Chloro-3-Methyl-2(3H)-Benzothiazolone; Brn 1212093 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H6ClNOS |
| Molecular Weight | 199.65 |
| CAS Registry Number | 63755-05-5 |
| SMILES | C2=C1SC(=O)N(C1=C(Cl)C=C2)C |
| InChI | 1S/C8H6ClNOS/c1-10-7-5(9)3-2-4-6(7)12-8(10)11/h2-4H,1H3 |
| InChIKey | QCPASDYEQAVIJF-UHFFFAOYSA-N |
| Density | 1.452g/cm3 (Cal.) |
|---|---|
| Boiling point | 324.988°C at 760 mmHg (Cal.) |
| Flash point | 150.348°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Chlobenthiazone |