Online Database of Chemicals from Around the World
|
CAS#: 63762-75-4 Product: N-[2-(6-Chloro-5-Methoxy-1H-Indol-3-Yl)Ethyl]Propionamide No suppilers available for the product. |
| Name | N-[2-(6-Chloro-5-Methoxy-1H-Indol-3-Yl)Ethyl]Propionamide |
|---|---|
| Synonyms | N-[2-(6-Chloro-5-Methoxy-1H-Indol-3-Yl)Ethyl]Propionamide; Brn 0418002; N-(2-(6-Chloro-5-Methoxy-3-Indolyl)Ethyl)Propionamide |
| Molecular Structure | ![CAS#: 63762-75-4, N-[2-(6-Chloro-5-Methoxy-1H-Indol-3-Yl)Ethyl]Propionamide](/moreStructures/63762-75-4.gif) |
| Molecular Formula | C14H17ClN2O2 |
| Molecular Weight | 280.75 |
| CAS Registry Number | 63762-75-4 |
| SMILES | C1=C(CCNC(CC)=O)C2=C([NH]1)C=C(C(=C2)OC)Cl |
| InChI | 1S/C14H17ClN2O2/c1-3-14(18)16-5-4-9-8-17-12-7-11(15)13(19-2)6-10(9)12/h6-8,17H,3-5H2,1-2H3,(H,16,18) |
| InChIKey | XSRWYGZSPYXVPC-UHFFFAOYSA-N |
| Density | 1.242g/cm3 (Cal.) |
|---|---|
| Boiling point | 540.103°C at 760 mmHg (Cal.) |
| Flash point | 280.444°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[2-(6-Chloro-5-Methoxy-1H-Indol-3-Yl)Ethyl]Propionamide |