|
CAS#: 63765-90-2 Product: N-(2-Methyl-2-Nitropropyl)-2-Ethylhexylamine No suppilers available for the product. |
| Name | N-(2-Methyl-2-Nitropropyl)-2-Ethylhexylamine |
|---|---|
| Synonyms | 2-Ethyl-N-(2-Methyl-2-Nitro-Propyl)Hexan-1-Amine; 2-Ethylhexyl-(2-Methyl-2-Nitro-Propyl)Amine; Hexylamine,N-(2-Nitro)Isobutyl-2-Ethyl |
| Molecular Structure | ![]() |
| Molecular Formula | C12H26N2O2 |
| Molecular Weight | 230.35 |
| CAS Registry Number | 63765-90-2 |
| SMILES | C(NCC(CCCC)CC)C([N+]([O-])=O)(C)C |
| InChI | 1S/C12H26N2O2/c1-5-7-8-11(6-2)9-13-10-12(3,4)14(15)16/h11,13H,5-10H2,1-4H3 |
| InChIKey | ZWNSDNRWTPIDSH-UHFFFAOYSA-N |
| Density | 0.926g/cm3 (Cal.) |
|---|---|
| Boiling point | 311.562°C at 760 mmHg (Cal.) |
| Flash point | 142.228°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(2-Methyl-2-Nitropropyl)-2-Ethylhexylamine |