|
CAS#: 6384-28-7 Product: 4,4-Dimethylcholest-7-Ene-3-Ol No suppilers available for the product. |
| Name | 4,4-Dimethylcholest-7-Ene-3-Ol |
|---|---|
| Synonyms | (3S,5R,9R,10R,13R,14R,17R)-17-[(1R)-1,5-Dimethylhexyl]-4,4,10,13-Tetramethyl-1,2,3,5,6,9,11,12,14,15,16,17-Dodecahydrocyclopenta[A]Phenanthren-3-Ol; 4,4-Dimethyl-5Alpha-Cholest-7-Ene-3Beta-Ol; 4,4-Dimethylcholest-7-Ene-3-Ol |
| Molecular Structure | ![]() |
| Molecular Formula | C29H50O |
| Molecular Weight | 414.71 |
| CAS Registry Number | 6384-28-7 |
| SMILES | [C@@H]24[C@@]1([C@H](C([C@@H](O)CC1)(C)C)CC=C2[C@H]3[C@@]([C@H](CC3)[C@@H](CCCC(C)C)C)(CC4)C)C |
| InChI | 1S/C29H50O/c1-19(2)9-8-10-20(3)22-12-13-23-21-11-14-25-27(4,5)26(30)16-18-29(25,7)24(21)15-17-28(22,23)6/h11,19-20,22-26,30H,8-10,12-18H2,1-7H3/t20-,22-,23+,24+,25+,26+,28-,29-/m1/s1 |
| InChIKey | UVNXFLZMQCAWCP-RCTKLBHESA-N |
| Density | 0.978g/cm3 (Cal.) |
|---|---|
| Boiling point | 492.366°C at 760 mmHg (Cal.) |
| Flash point | 217.602°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4-Dimethylcholest-7-Ene-3-Ol |