|
CAS#: 6384-73-2 Product: 1alpha,4alpha-Epoxy-16beta-Hydroxy-3-Aza-alpha-Homo-5beta-Pregnan-21-Oic Acid gamma-Lactone No suppilers available for the product. |
| Name | 1alpha,4alpha-Epoxy-16beta-Hydroxy-3-Aza-alpha-Homo-5beta-Pregnan-21-Oic Acid gamma-Lactone |
|---|---|
| Synonyms | 4-27-00-06565 (Beilstein Handbook Reference); Brn 0038144; Samandaridin |
| Molecular Structure | ![]() |
| Molecular Formula | C21H31NO3 |
| Molecular Weight | 345.48 |
| CAS Registry Number | 6384-73-2 |
| SMILES | [C@@H]12OC(C[C@@H]1[C@@]3([C@@H](C2)[C@H]4[C@H](CC3)[C@@]5([C@H](CC4)C[C@@H]6NC[C@H]5O6)C)C)=O |
| InChI | 1S/C21H31NO3/c1-20-6-5-13-12(14(20)8-16-15(20)9-19(23)24-16)4-3-11-7-18-22-10-17(25-18)21(11,13)2/h11-18,22H,3-10H2,1-2H3/t11-,12-,13+,14+,15+,16+,17-,18-,20+,21+/m1/s1 |
| InChIKey | GUSZSGSYIVZEDM-ACYPXLHBSA-N |
| Density | 1.154g/cm3 (Cal.) |
|---|---|
| Boiling point | 498.929°C at 760 mmHg (Cal.) |
| Flash point | 255.543°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1alpha,4alpha-Epoxy-16beta-Hydroxy-3-Aza-alpha-Homo-5beta-Pregnan-21-Oic Acid gamma-Lactone |