|
CAS#: 63867-10-7 Product: 2-Chloro-2-Ethylbutyric Acid 2,2,2-Trichloroethyl Ester No suppilers available for the product. |
| Name | 2-Chloro-2-Ethylbutyric Acid 2,2,2-Trichloroethyl Ester |
|---|---|
| Synonyms | 2,2,2-Trichloroethyl 2-Chloro-2-Ethyl-Butanoate; 2-Chloro-2-Ethylbutanoic Acid 2,2,2-Trichloroethyl Ester; 2-Chloro-2-Ethyl-Butyric Acid 2,2,2-Trichloroethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C8H12Cl4O2 |
| Molecular Weight | 281.99 |
| CAS Registry Number | 63867-10-7 |
| SMILES | C(C(C(OCC(Cl)(Cl)Cl)=O)(CC)Cl)C |
| InChI | 1S/C8H12Cl4O2/c1-3-7(9,4-2)6(13)14-5-8(10,11)12/h3-5H2,1-2H3 |
| InChIKey | VCWJEHDQXIPHQM-UHFFFAOYSA-N |
| Density | 1.345g/cm3 (Cal.) |
|---|---|
| Boiling point | 334.973°C at 760 mmHg (Cal.) |
| Flash point | 132.95°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-2-Ethylbutyric Acid 2,2,2-Trichloroethyl Ester |