|
CAS#: 63867-33-4 Product: Oxalic Acid Bis(4-Methylphenyl) Ester No suppilers available for the product. |
| Name | Oxalic Acid Bis(4-Methylphenyl) Ester |
|---|---|
| Synonyms | Oxalic Acid Bis(3-Methylphenyl) Ester; Bis(3-Methylphenyl) Ethanedioate; 4-06-00-02114 (Beilstein Handbook Reference) |
| Molecular Structure | ![]() |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.28 |
| CAS Registry Number | 63867-33-4 |
| SMILES | C2=CC=C(OC(=O)C(=O)OC1=CC(=CC=C1)C)C=C2C |
| InChI | 1S/C16H14O4/c1-11-5-3-7-13(9-11)19-15(17)16(18)20-14-8-4-6-12(2)10-14/h3-10H,1-2H3 |
| InChIKey | RRJJVVWKGKHXFO-UHFFFAOYSA-N |
| Density | 1.201g/cm3 (Cal.) |
|---|---|
| Boiling point | 376.864°C at 760 mmHg (Cal.) |
| Flash point | 165.455°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Oxalic Acid Bis(4-Methylphenyl) Ester |