|
CAS#: 63869-30-7 Product: (2-Chloro-1-Hexenyl)Dichlorophosphine Oxide No suppilers available for the product. |
| Name | (2-Chloro-1-Hexenyl)Dichlorophosphine Oxide |
|---|---|
| Synonyms | (Z)-2-Chloro-1-Dichlorophosphoryl-Hex-1-Ene; 1-Hexene, 2-Chloro-1-Phosphonyl Chloride; Phosphonic Dichloride, (2-Chlorohex-1-Enyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C6H10Cl3OP |
| Molecular Weight | 235.48 |
| CAS Registry Number | 63869-30-7 |
| SMILES | C(/C(=C/[P](=O)(Cl)Cl)Cl)CCC |
| InChI | 1S/C6H10Cl3OP/c1-2-3-4-6(7)5-11(8,9)10/h5H,2-4H2,1H3/b6-5- |
| InChIKey | LMKFDUVACNJAEN-WAYWQWQTSA-N |
| Density | 1.313g/cm3 (Cal.) |
|---|---|
| Boiling point | 266.689°C at 760 mmHg (Cal.) |
| Flash point | 115.09°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2-Chloro-1-Hexenyl)Dichlorophosphine Oxide |