|
CAS#: 63884-77-5 Product: beta,gamma,gamma-Trimethylhexanal Thiosemicarbazone No suppilers available for the product. |
| Name | beta,gamma,gamma-Trimethylhexanal Thiosemicarbazone |
|---|---|
| Synonyms | Caproaldehyde, Beta,Gamma,Gamma-Trimethyl-, Thiosemicarbazone; Beta,Gamma,Gamma-Trimethylcaproaldehyde Thiosemicarbazone |
| Molecular Structure | ![]() |
| Molecular Formula | C10H21N3S |
| Molecular Weight | 215.36 |
| CAS Registry Number | 63884-77-5 |
| SMILES | C(C(C(CC)(C)C)C)/C=N/NC(=S)N |
| InChI | 1S/C10H21N3S/c1-5-10(3,4)8(2)6-7-12-13-9(11)14/h7-8H,5-6H2,1-4H3,(H3,11,13,14)/b12-7+ |
| InChIKey | VPZPJMBRIGXSBI-KPKJPENVSA-N |
| Density | 1.024g/cm3 (Cal.) |
|---|---|
| Boiling point | 305.318°C at 760 mmHg (Cal.) |
| Flash point | 138.451°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for beta,gamma,gamma-Trimethylhexanal Thiosemicarbazone |