Online Database of Chemicals from Around the World
|
CAS#: 63887-28-5 Product: 4-Amino-3,5-Dichloro-N-Ethylbenzamide No suppilers available for the product. |
| Name | 4-Amino-3,5-Dichloro-N-Ethylbenzamide |
|---|---|
| Synonyms | 4-Amino-3,5-Dichloro-N-Ethyl-Benzamide; Benzamide, 4-Amino-3,5-Dichloro-N-Ethyl-; Brn 2730808 |
| Molecular Structure |  |
| Molecular Formula | C9H10Cl2N2O |
| Molecular Weight | 233.10 |
| CAS Registry Number | 63887-28-5 |
| SMILES | C1=C(Cl)C(=C(Cl)C=C1C(NCC)=O)N |
| InChI | 1S/C9H10Cl2N2O/c1-2-13-9(14)5-3-6(10)8(12)7(11)4-5/h3-4H,2,12H2,1H3,(H,13,14) |
| InChIKey | WOLIADBLOGKYQS-UHFFFAOYSA-N |
| Density | 1.351g/cm3 (Cal.) |
|---|---|
| Boiling point | 317.051°C at 760 mmHg (Cal.) |
| Flash point | 145.547°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Amino-3,5-Dichloro-N-Ethylbenzamide |