|
CAS#: 639-41-8 Product: Crinamine No suppilers available for the product. |
| Name | Crinamine |
|---|---|
| Synonyms | C08525; Crinamine |
| Molecular Structure | ![]() |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 |
| CAS Registry Number | 639-41-8 |
| SMILES | [C@@]145[C@@H](N(CC2=CC3=C(C=C12)OCO3)C[C@H]4O)C[C@H](C=C5)OC |
| InChI | 1S/C17H19NO4/c1-20-11-2-3-17-12-6-14-13(21-9-22-14)4-10(12)7-18(8-16(17)19)15(17)5-11/h2-4,6,11,15-16,19H,5,7-9H2,1H3/t11-,15-,16+,17-/m0/s1 |
| InChIKey | YGPRSGKVLATIHT-UQCMEYCASA-N |
| Density | 1.422g/cm3 (Cal.) |
|---|---|
| Boiling point | 467.523°C at 760 mmHg (Cal.) |
| Flash point | 236.55°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Crinamine |