|
CAS#: 63906-86-5 Product: 2-Methoxy-3-Phenylbenzamide No suppilers available for the product. |
| Name | 2-Methoxy-3-Phenylbenzamide |
|---|---|
| Synonyms | 2-Methoxy-3-Phenyl-Benzamide; Benzamide, 2-Methoxy-3-Phenyl-; Brn 3298211 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 |
| CAS Registry Number | 63906-86-5 |
| SMILES | C1=CC=C(C(=C1C2=CC=CC=C2)OC)C(N)=O |
| InChI | 1S/C14H13NO2/c1-17-13-11(10-6-3-2-4-7-10)8-5-9-12(13)14(15)16/h2-9H,1H3,(H2,15,16) |
| InChIKey | AXOZSLHVJTYWQM-UHFFFAOYSA-N |
| Density | 1.151g/cm3 (Cal.) |
|---|---|
| Boiling point | 347.26°C at 760 mmHg (Cal.) |
| Flash point | 149.849°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methoxy-3-Phenylbenzamide |