|
CAS#: 63938-01-2 Product: 2-Methyl-1-(3-Nitrophenethyl)-1,2,3,4,5,6,7,8-Octahydroisoquinoline No suppilers available for the product. |
| Name | 2-Methyl-1-(3-Nitrophenethyl)-1,2,3,4,5,6,7,8-Octahydroisoquinoline |
|---|---|
| Synonyms | Isoquinoline, 1,2,3,4,5,6,7,8-Octahydro-2-Methyl-1-(3-Nitrophenethyl)-; Isoquinoline, 2-Methyl-1-(3-Nitrophenethyl)-1,2,3,4,5,6,7,8-Octahydro-; 1-(3-Nitrophenethyl)-2-Methyl-1,2,3,4,5,6,7,8-Octahydroisoquinoline |
| Molecular Structure | ![]() |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 |
| CAS Registry Number | 63938-01-2 |
| SMILES | C3=C(CCC1N(CCC2=C1CCCC2)C)C=CC=C3[N+]([O-])=O |
| InChI | 1S/C18H24N2O2/c1-19-12-11-15-6-2-3-8-17(15)18(19)10-9-14-5-4-7-16(13-14)20(21)22/h4-5,7,13,18H,2-3,6,8-12H2,1H3 |
| InChIKey | XQUJIUXPLNHJMQ-UHFFFAOYSA-N |
| Density | 1.152g/cm3 (Cal.) |
|---|---|
| Boiling point | 449.485°C at 760 mmHg (Cal.) |
| Flash point | 225.641°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-1-(3-Nitrophenethyl)-1,2,3,4,5,6,7,8-Octahydroisoquinoline |