|
CAS#: 63978-75-6 Product: 2-Chloroethyl-Bis(2-Hydroxyethyl)Ammonium chloride No suppilers available for the product. |
| Name | 2-Chloroethyl-Bis(2-Hydroxyethyl)Ammonium chloride |
|---|---|
| Synonyms | Triethylamine, 2-Chloro-2,2'-Dihydroxy-, Hydrochloride; Beta-Chloroethyl-Bis(Beta-Hydroxyethyl)Amine Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C6H15Cl2NO2 |
| Molecular Weight | 204.10 |
| CAS Registry Number | 63978-75-6 |
| SMILES | [H+].C(N(CCO)CC)C(Cl)O.[Cl-] |
| InChI | 1S/C6H14ClNO2.ClH/c1-2-8(3-4-9)5-6(7)10;/h6,9-10H,2-5H2,1H3;1H |
| InChIKey | SKSPIMUPRZFRAG-UHFFFAOYSA-N |
| Boiling point | 230.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 93.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloroethyl-Bis(2-Hydroxyethyl)Ammonium chloride |