|
CAS#: 63979-82-8 Product: 3,3,4,4-Tetrakis[(Z)-Prop-1-Enyl]Oxolane-2,5-Dione No suppilers available for the product. |
| Name | 3,3,4,4-Tetrakis[(Z)-Prop-1-Enyl]Oxolane-2,5-Dione |
|---|---|
| Synonyms | Nsc41536 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 |
| CAS Registry Number | 63979-82-8 |
| SMILES | C\C=C\C1(C(=O)OC(C1(\C=C/C)/C=C/C)=O)\C=C\C |
| InChI | 1S/C16H20O3/c1-5-9-15(10-6-2)13(17)19-14(18)16(15,11-7-3)12-8-4/h5-12H,1-4H3/b9-5-,10-6+,11-7+,12-8+ |
| InChIKey | OYNOZYCJSZYBNV-GFJZJREDSA-N |
| Density | 1.221g/cm3 (Cal.) |
|---|---|
| Boiling point | 370.584°C at 760 mmHg (Cal.) |
| Flash point | 165.818°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3,4,4-Tetrakis[(Z)-Prop-1-Enyl]Oxolane-2,5-Dione |