|
CAS#: 63981-14-6 Product: 2-[(Trichloroacryloyl)Oxy]Benzoic Acid No suppilers available for the product. |
| Name | 2-[(Trichloroacryloyl)Oxy]Benzoic Acid |
|---|---|
| Synonyms | 2-(2,3,3-Trichloro-1-Oxoprop-2-Enoxy)Benzoic Acid; 2-(2,3,3-Trichloroacryloyl)Oxybenzoic Acid; O-Trichloroacroylsalicylic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C10H5Cl3O4 |
| Molecular Weight | 295.51 |
| CAS Registry Number | 63981-14-6 |
| SMILES | C1=C(C(=CC=C1)C(=O)O)OC(C(=C(Cl)Cl)Cl)=O |
| InChI | 1S/C10H5Cl3O4/c11-7(8(12)13)10(16)17-6-4-2-1-3-5(6)9(14)15/h1-4H,(H,14,15) |
| InChIKey | YDBGLAWPVCIXEA-UHFFFAOYSA-N |
| Density | 1.611g/cm3 (Cal.) |
|---|---|
| Boiling point | 401.048°C at 760 mmHg (Cal.) |
| Flash point | 196.347°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(Trichloroacryloyl)Oxy]Benzoic Acid |