|
CAS#: 639815-70-6 Product: 3-Ethoxy-5-(trichloromethyl)-4,5-dihydro-1,2-oxazol-5-ol No suppilers available for the product. |
| Name | 3-Ethoxy-5-(trichloromethyl)-4,5-dihydro-1,2-oxazol-5-ol |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C6H8Cl3NO3 |
| Molecular Weight | 248.49 |
| CAS Registry Number | 639815-70-6 |
| SMILES | CCOC=1CC(O)(ON=1)C(Cl)(Cl)Cl |
| InChI | 1S/C6H8Cl3NO3/c1-2-12-4-3-5(11,13-10-4)6(7,8)9/h11H,2-3H2,1H3 |
| InChIKey | VQUGUNHKTRLROF-UHFFFAOYSA-N |
| Density | 1.62g/cm3 (Cal.) |
|---|---|
| Boiling point | 299.112°C at 760 mmHg (Cal.) |
| Flash point | 134.698°C (Cal.) |
| Refractive index | 1.552 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Ethoxy-5-(trichloromethyl)-4,5-dihydro-1,2-oxazol-5-ol |