Online Database of Chemicals from Around the World
|
CAS#: 63992-30-3 Product: 4,4'-Di-Tert-Butyl-2,2'-Biphenol No suppilers available for the product. |
| Name | 4,4'-Di-Tert-Butyl-2,2'-Biphenol |
|---|---|
| Synonyms | 5-Tert-Butyl-2-(4-Tert-Butyl-2-Hydroxy-Phenyl)Phenol; 2,2'-Biphenyldiol, 4,4'-Di-Tert-Butyl-; 4,4'-Di-Tert-Butyl-O,O'-Biphenol |
| Molecular Structure |  |
| Molecular Formula | C20H26O2 |
| Molecular Weight | 298.42 |
| CAS Registry Number | 63992-30-3 |
| SMILES | C2=C(C1=C(O)C=C(C(C)(C)C)C=C1)C(=CC(=C2)C(C)(C)C)O |
| InChI | 1S/C20H26O2/c1-19(2,3)13-7-9-15(17(21)11-13)16-10-8-14(12-18(16)22)20(4,5)6/h7-12,21-22H,1-6H3 |
| InChIKey | ITTKJDWXXRDSQO-UHFFFAOYSA-N |
| Density | 1.047g/cm3 (Cal.) |
|---|---|
| Boiling point | 401.498°C at 760 mmHg (Cal.) |
| Flash point | 176.057°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4'-Di-Tert-Butyl-2,2'-Biphenol |