|
CAS#: 63992-45-0 Product: N,N-Diethyl-2-Hydroxy-1,1'-Biphenyl-3-Carboxamide No suppilers available for the product. |
| Name | N,N-Diethyl-2-Hydroxy-1,1'-Biphenyl-3-Carboxamide |
|---|---|
| Synonyms | N,N-Diethyl-2-Hydroxy-3-Phenyl-Benzamide; Aids-167480; Aids167480 |
| Molecular Structure | ![]() |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 |
| CAS Registry Number | 63992-45-0 |
| SMILES | C2=C(C(N(CC)CC)=O)C(=C(C1=CC=CC=C1)C=C2)O |
| InChI | 1S/C17H19NO2/c1-3-18(4-2)17(20)15-12-8-11-14(16(15)19)13-9-6-5-7-10-13/h5-12,19H,3-4H2,1-2H3 |
| InChIKey | XQTMNRKZPMKUHJ-UHFFFAOYSA-N |
| Density | 1.116g/cm3 (Cal.) |
|---|---|
| Boiling point | 448.583°C at 760 mmHg (Cal.) |
| Flash point | 225.095°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Diethyl-2-Hydroxy-1,1'-Biphenyl-3-Carboxamide |