|
CAS#: 63998-61-8 Product: Tibalosin Hydrochloride No suppilers available for the product. |
| Name | Tibalosin Hydrochloride |
|---|---|
| Synonyms | 1-(2,3-Dihydrobenzothiophen-5-Yl)-2-(4-Phenylbutylamino)Propan-1-Ol Hydrochloride; Tibalosine; Cp 804-S |
| Molecular Structure | ![]() |
| Molecular Formula | C21H28ClNOS |
| Molecular Weight | 377.97 |
| CAS Registry Number | 63998-61-8 |
| SMILES | [H+].C2=C(C(O)C(NCCCCC1=CC=CC=C1)C)C=CC3=C2CCS3.[Cl-] |
| InChI | 1S/C21H27NOS.ClH/c1-16(22-13-6-5-9-17-7-3-2-4-8-17)21(23)19-10-11-20-18(15-19)12-14-24-20;/h2-4,7-8,10-11,15-16,21-23H,5-6,9,12-14H2,1H3;1H |
| InChIKey | DGDBUWWQDGGWQV-UHFFFAOYSA-N |
| Boiling point | 525.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 271.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tibalosin Hydrochloride |