|
CAS#: 64047-47-8 Product: 2-Bromoisovaleric Acid 2,2,2-Tribromoethyl Ester No suppilers available for the product. |
| Name | 2-Bromoisovaleric Acid 2,2,2-Tribromoethyl Ester |
|---|---|
| Synonyms | 2,2,2-Tribromoethyl 2-Bromo-3-Methyl-Butanoate; 2-Bromo-3-Methylbutanoic Acid 2,2,2-Tribromoethyl Ester; 2-Bromo-3-Methyl-Butyric Acid 2,2,2-Tribromoethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C7H10Br4O2 |
| Molecular Weight | 445.77 |
| CAS Registry Number | 64047-47-8 |
| SMILES | C(C(Br)(Br)Br)OC(C(C(C)C)Br)=O |
| InChI | 1S/C7H10Br4O2/c1-4(2)5(8)6(12)13-3-7(9,10)11/h4-5H,3H2,1-2H3 |
| InChIKey | OSZOQLCMBZVJQQ-UHFFFAOYSA-N |
| Density | 2.217g/cm3 (Cal.) |
|---|---|
| Boiling point | 377.339°C at 760 mmHg (Cal.) |
| Flash point | 182.008°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Bromoisovaleric Acid 2,2,2-Tribromoethyl Ester |