|
CAS#: 64070-86-6 Product: Manganese(II)Bis(4-Nitrophenolate) No suppilers available for the product. |
| Name | Manganese(II)Bis(4-Nitrophenolate) |
|---|---|
| Synonyms | Manganous 4-Nitrophenolate; Phenol, P-Nitro-, Manganese(Ii) Salt; P-Nitrophenol Manganese(Ii) Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C12H8MnN2O6 |
| Molecular Weight | 331.14 |
| CAS Registry Number | 64070-86-6 |
| SMILES | C1=C([N+](=O)[O-])C=CC(=C1)[O-].C2=C([N+]([O-])=O)C=CC(=C2)[O-].[Mn++] |
| InChI | 1S/2C6H5NO3.Mn/c2*8-6-3-1-5(2-4-6)7(9)10;/h2*1-4,8H;/q;;+2/p-2 |
| InChIKey | VDFCCLGAZFRJFE-UHFFFAOYSA-L |
| Boiling point | 279°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 141.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Manganese(II)Bis(4-Nitrophenolate) |