|
CAS#: 64114-64-3 Product: Sodium Isobutyloctyl Phosphate No suppilers available for the product. |
| Name | Sodium Isobutyloctyl Phosphate |
|---|---|
| Synonyms | Sodium 1-Isobutyloctyl Phosphate; Sodium Isobutyloctyl Phosphate |
| Molecular Structure | ![]() |
| Molecular Formula | C12H25NaO4P |
| Molecular Weight | 287.29 |
| CAS Registry Number | 64114-64-3 |
| EINECS | 264-678-1 |
| SMILES | C(C(O[P]([O-])([O-])=O)CCCCCCC)C(C)C.[Na+] |
| InChI | 1S/C12H27O4P.Na/c1-4-5-6-7-8-9-12(10-11(2)3)16-17(13,14)15;/h11-12H,4-10H2,1-3H3,(H2,13,14,15);/q;+1/p-2 |
| InChIKey | RCXXCYUTLKKTBA-UHFFFAOYSA-L |
| Boiling point | 374.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 180.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sodium Isobutyloctyl Phosphate |