|
CAS#: 6413-68-9 Product: 8-Ethyl-8-Nitro-6,10-Dioxaspiro[4.5]Decane No suppilers available for the product. |
| Name | 8-Ethyl-8-Nitro-6,10-Dioxaspiro[4.5]Decane |
|---|---|
| Synonyms | Nsc75254 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.25 |
| CAS Registry Number | 6413-68-9 |
| SMILES | C(C)C2(COC1(CCCC1)OC2)[N+]([O-])=O |
| InChI | 1S/C10H17NO4/c1-2-9(11(12)13)7-14-10(15-8-9)5-3-4-6-10/h2-8H2,1H3 |
| InChIKey | GARRXWMJTUZFAV-UHFFFAOYSA-N |
| Density | 1.182g/cm3 (Cal.) |
|---|---|
| Boiling point | 325.278°C at 760 mmHg (Cal.) |
| Flash point | 142.267°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-Ethyl-8-Nitro-6,10-Dioxaspiro[4.5]Decane |