|
CAS#: 64143-07-3 Product: 1-Acetyl-3,5-Dimethyl-2-Thio-Hydantoin No suppilers available for the product. |
| Name | 1-Acetyl-3,5-Dimethyl-2-Thio-Hydantoin |
|---|---|
| Synonyms | 1-Acetyl-3,5-Dimethyl-2-Thioxo-Imidazolidin-4-One; 1-Acetyl-3,5-Dimethyl-2-Thioxo-4-Imidazolidinone; 1-Ethanoyl-3,5-Dimethyl-2-Sulfanylidene-Imidazolidin-4-One |
| Molecular Structure | ![]() |
| Molecular Formula | C7H10N2O2S |
| Molecular Weight | 186.23 |
| CAS Registry Number | 64143-07-3 |
| SMILES | CN1C(C(N(C1=S)C(C)=O)C)=O |
| InChI | 1S/C7H10N2O2S/c1-4-6(11)8(3)7(12)9(4)5(2)10/h4H,1-3H3 |
| InChIKey | UOCDUHWIIWYTIJ-UHFFFAOYSA-N |
| Density | 1.337g/cm3 (Cal.) |
|---|---|
| Boiling point | 246.907°C at 760 mmHg (Cal.) |
| Flash point | 103.126°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Acetyl-3,5-Dimethyl-2-Thio-Hydantoin |