|
CAS#: 64153-52-2 Product: 14-Ethylcholest-7-Ene-3,15-Diol No suppilers available for the product. |
| Name | 14-Ethylcholest-7-Ene-3,15-Diol |
|---|---|
| Synonyms | (3S,5S,9R,10S,13R,15S,17R)-17-[(1R)-1,5-Dimethylhexyl]-14-Ethyl-10,13-Dimethyl-1,2,3,4,5,6,9,11,12,15,16,17-Dodecahydrocyclopenta[A]Phenanthrene-3,15-Diol; 14-Et-Ce-3,15-Diol; 14-Ethylcholest-7-Ene-3,15-Diol |
| Molecular Structure | ![]() |
| Molecular Formula | C29H50O2 |
| Molecular Weight | 430.71 |
| CAS Registry Number | 64153-52-2 |
| SMILES | [C@]24(C(C1=CC[C@@H]3[C@@]([C@H]1CC2)(CC[C@H](O)C3)C)([C@@H](O)C[C@@H]4[C@@H](CCCC(C)C)C)CC)C |
| InChI | 1S/C29H50O2/c1-7-29-24-12-11-21-17-22(30)13-15-27(21,5)23(24)14-16-28(29,6)25(18-26(29)31)20(4)10-8-9-19(2)3/h12,19-23,25-26,30-31H,7-11,13-18H2,1-6H3/t20-,21+,22+,23+,25-,26+,27+,28-,29?/m1/s1 |
| InChIKey | QGLIKDSBWIUDFT-JPFRARASSA-N |
| Density | 1.022g/cm3 (Cal.) |
|---|---|
| Boiling point | 527.417°C at 760 mmHg (Cal.) |
| Flash point | 214.322°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 14-Ethylcholest-7-Ene-3,15-Diol |