|
CAS#: 642-39-7 Product: 1-(2,4-Dihydroxyphenyl)-2-(4-Methoxyphenyl)-1-Propanone No suppilers available for the product. |
| Name | 1-(2,4-Dihydroxyphenyl)-2-(4-Methoxyphenyl)-1-Propanone |
|---|---|
| Synonyms | (2R)-1-(2,4-DIHYDROXYPHENYL)-2-(4-METHOXYPHENYL)PROPAN-1-ONE |
| Molecular Structure | ![]() |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.30 |
| CAS Registry Number | 642-39-7 |
| SMILES | CC(C1=CC=C(C=C1)OC)C(=O)C2=C(C=C(C=C2)O)O |
| InChI | 1S/C16H16O4/c1-10(11-3-6-13(20-2)7-4-11)16(19)14-8-5-12(17)9-15(14)18/h3-10,17-18H,1-2H3 |
| InChIKey | CCOJFDRSZSSKOG-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 464.9±24.0°C at 760 mmHg (Cal.) |
| Flash point | 173.3±16.4°C (Cal.) |
| (1) | Kristiina Wähälä, Tuija Jokela, Auli Salakka, Seppo Kaltia and Markku Mesilaakso. Regioselectivity of methylation of O-demethylangolensin [1-(2,4-dihydroxyphenyl)-2-(4-hydroxyphenyl)propan-1-one]. An expedient synthesis of angolensin, J. Chem. Soc., Perkin Trans. 1, 2001, 0, 642. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 1-(2,4-Dihydroxyphenyl)-2-(4-Methoxyphenyl)-1-Propanone |