|
CAS#: 642-73-9 Product: Bis(3,4,5-Trimethoxyphenethylammonium) Sulphate No suppilers available for the product. |
| Name | Bis(3,4,5-Trimethoxyphenethylammonium) Sulphate |
|---|---|
| Synonyms | Sulfuric Acid; 2-(3,4,5-Trimethoxyphenyl)Ethylamine; Bis(3,4,5-Trimethoxyphenethylammonium) Sulphate |
| Molecular Structure | ![]() |
| Molecular Formula | C11H19NO7S |
| Molecular Weight | 309.33 |
| CAS Registry Number | 642-73-9 |
| EINECS | 211-389-3 |
| SMILES | C1=C(CCN)C=C(C(=C1OC)OC)OC.O=[S](O)(O)=O |
| InChI | 1S/C11H17NO3.H2O4S/c1-13-9-6-8(4-5-12)7-10(14-2)11(9)15-3;1-5(2,3)4/h6-7H,4-5,12H2,1-3H3;(H2,1,2,3,4) |
| InChIKey | AEEOQROQKAFCJB-UHFFFAOYSA-N |
| Boiling point | 312.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 145.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(3,4,5-Trimethoxyphenethylammonium) Sulphate |