|
CAS#: 64258-03-3 Product: 2,4'',6-Tribromobiphenyl No suppilers available for the product. |
| Name | 2,4'',6-Tribromobiphenyl |
|---|---|
| Synonyms | 1,1'-Biphenyl, 2,4',6-Tribromo-; 2,4',6-Tribromo-1,1'-Biphenyl |
| Molecular Structure | ![]() |
| Molecular Formula | C12H7Br3 |
| Molecular Weight | 390.90 |
| CAS Registry Number | 64258-03-3 |
| SMILES | C1=C(C(=C(C=C1)Br)C2=CC=C(C=C2)Br)Br |
| InChI | 1S/C12H7Br3/c13-9-6-4-8(5-7-9)12-10(14)2-1-3-11(12)15/h1-7H |
| InChIKey | BCWVIZFLJCJGPL-UHFFFAOYSA-N |
| Density | 1.923g/cm3 (Cal.) |
|---|---|
| Boiling point | 374.422°C at 760 mmHg (Cal.) |
| Flash point | 175.156°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4'',6-Tribromobiphenyl |