Online Database of Chemicals from Around the World
| Name | 1,2,3,6,7,9-Hexachlorodibenzo-Para-Dioxin |
|---|---|
| Synonyms | 1,2,3,6,7,9-Hexachlorodibenzo-P-Dioxin; 1,2,3,6,7,9-Hexachlorodibenzo-Para-Dioxin; 1,2,3,6,7,9-Hexachlorodibenzodioxin |
| Molecular Structure |  |
| Molecular Formula | C12H2Cl6O2 |
| Molecular Weight | 390.86 |
| CAS Registry Number | 64461-98-9 |
| SMILES | C1=C(C(=C(C2=C1OC3=C(O2)C(=CC(=C3Cl)Cl)Cl)Cl)Cl)Cl |
| InChI | 1S/C12H2Cl6O2/c13-3-1-5(15)10-12(8(3)17)19-6-2-4(14)7(16)9(18)11(6)20-10/h1-2H |
| InChIKey | BQOHWGKNRKCEFT-UHFFFAOYSA-N |
| Density | 1.778g/cm3 (Cal.) |
|---|---|
| Boiling point | 473.476°C at 760 mmHg (Cal.) |
| Flash point | 180.716°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,6,7,9-Hexachlorodibenzo-Para-Dioxin |
