|
CAS#: 64497-95-6 Product: 1-(1-Benzyl-5-Methyl-4H-Pyridin-3-Yl)Ethanone No suppilers available for the product. |
| Name | 1-(1-Benzyl-5-Methyl-4H-Pyridin-3-Yl)Ethanone |
|---|---|
| Synonyms | 1-[1-(Benzyl)-5-Methyl-4H-Pyridin-3-Yl]Ethanone; Nsc302676 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.31 |
| CAS Registry Number | 64497-95-6 |
| SMILES | C2=C(CN1C=C(C(=O)C)CC(=C1)C)C=CC=C2 |
| InChI | 1S/C15H17NO/c1-12-8-15(13(2)17)11-16(9-12)10-14-6-4-3-5-7-14/h3-7,9,11H,8,10H2,1-2H3 |
| InChIKey | HSFUOCFDKDABGW-UHFFFAOYSA-N |
| Density | 1.084g/cm3 (Cal.) |
|---|---|
| Boiling point | 376.244°C at 760 mmHg (Cal.) |
| Flash point | 144.044°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(1-Benzyl-5-Methyl-4H-Pyridin-3-Yl)Ethanone |