|
CAS#: 6460-95-3 Product: N-Benzoyl-L-Glutamic Acid 5-Benzyl Ester No suppilers available for the product. |
| Name | N-Benzoyl-L-Glutamic Acid 5-Benzyl Ester |
|---|---|
| Synonyms | (2S)-5-Oxo-2-[(Oxo-Phenylmethyl)Amino]-5-(Phenylmethoxy)Pentanoic Acid; (2S)-2-(Benzoylamino)-5-(Benzyloxy)-5-Keto-Valeric Acid; (2S)-5-Oxo-2-(Phenylcarbonylamino)-5-(Phenylmethoxy)Pentanoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 341.36 |
| CAS Registry Number | 6460-95-3 |
| SMILES | [C@H](C(=O)O)(NC(C1=CC=CC=C1)=O)CCC(=O)OCC2=CC=CC=C2 |
| InChI | 1S/C19H19NO5/c21-17(25-13-14-7-3-1-4-8-14)12-11-16(19(23)24)20-18(22)15-9-5-2-6-10-15/h1-10,16H,11-13H2,(H,20,22)(H,23,24)/t16-/m0/s1 |
| InChIKey | PMEFERULLAYXGE-INIZCTEOSA-N |
| Density | 1.257g/cm3 (Cal.) |
|---|---|
| Boiling point | 618.41°C at 760 mmHg (Cal.) |
| Flash point | 327.803°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Benzoyl-L-Glutamic Acid 5-Benzyl Ester |