|
CAS#: 64667-33-0 Product: Methyl 4,6,6,6-Tetrachloro-3,3-Dimethylhexanoate No suppilers available for the product. |
| Name | Methyl 4,6,6,6-Tetrachloro-3,3-Dimethylhexanoate |
|---|---|
| Synonyms | Methyl 4,6,6,6-Tetrachloro-3,3-Dimethyl-Hexanoate; 4,6,6,6-Tetrachloro-3,3-Dimethylhexanoic Acid Methyl Ester; 4,6,6,6-Tetrachloro-3,3-Dimethyl-Hexanoic Acid Methyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C9H14Cl4O2 |
| Molecular Weight | 296.02 |
| CAS Registry Number | 64667-33-0 |
| EINECS | 265-005-4 |
| SMILES | C(C(OC)=O)C(C(CC(Cl)(Cl)Cl)Cl)(C)C |
| InChI | 1S/C9H14Cl4O2/c1-8(2,5-7(14)15-3)6(10)4-9(11,12)13/h6H,4-5H2,1-3H3 |
| InChIKey | POFHGKISWXYKLB-UHFFFAOYSA-N |
| Density | 1.306g/cm3 (Cal.) |
|---|---|
| Boiling point | 297.983°C at 760 mmHg (Cal.) |
| Flash point | 106.194°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 4,6,6,6-Tetrachloro-3,3-Dimethylhexanoate |