|
CAS#: 64884-42-0 Product: 4H-Cyclopenta(Def)Phenanthren-4-Ol No suppilers available for the product. |
| Name | 4H-Cyclopenta(Def)Phenanthren-4-Ol |
|---|---|
| Synonyms | Ccris 7298 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H10O |
| Molecular Weight | 206.24 |
| CAS Registry Number | 64884-42-0 |
| SMILES | C3=C2C=CC1=CC=CC4=C1C2=C(C=C3)C4O |
| InChI | 1S/C15H10O/c16-15-11-5-1-3-9-7-8-10-4-2-6-12(15)14(10)13(9)11/h1-8,15-16H |
| InChIKey | UWAIRMQUVIHZAR-UHFFFAOYSA-N |
| Density | 1.391g/cm3 (Cal.) |
|---|---|
| Boiling point | 449.802°C at 760 mmHg (Cal.) |
| Flash point | 158.599°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4H-Cyclopenta(Def)Phenanthren-4-Ol |