|
CAS#: 64920-12-3 Product: 1-(2-Carboxyethyl)Adenine No suppilers available for the product. |
| Name | 1-(2-Carboxyethyl)Adenine |
|---|---|
| Synonyms | 3-(6-Amino-1-Purinyl)Propanoic Acid; 3-(6-Aminopurin-1-Yl)Propionic Acid; 1-(2-Carboxyethyl)Adenine |
| Molecular Structure | ![]() |
| Molecular Formula | C8H9N5O2 |
| Molecular Weight | 207.19 |
| CAS Registry Number | 64920-12-3 |
| SMILES | C([N]2C(=C1N=CN=C1N=C2)N)CC(O)=O |
| InChI | 1S/C8H9N5O2/c9-7-6-8(11-3-10-6)12-4-13(7)2-1-5(14)15/h3-4H,1-2,9H2,(H,14,15) |
| InChIKey | GIUJERYETBHNEB-UHFFFAOYSA-N |
| Density | 1.717g/cm3 (Cal.) |
|---|---|
| Boiling point | 404.846°C at 760 mmHg (Cal.) |
| Flash point | 198.644°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2-Carboxyethyl)Adenine |