|
CAS#: 6493-69-2 Product: Stannic citrate No suppilers available for the product. |
| Name | Stannic citrate |
|---|---|
| Synonyms | Stannous 2-(Carboxymethyl)-2-Hydroxy-Butanedioate; Stannous 2-(Carboxymethyl)-2-Hydroxybutanedioate; Stannous 2-(Carboxymethyl)-2-Hydroxy-Succinate |
| Molecular Structure | ![]() |
| Molecular Formula | C6H6O7Sn |
| Molecular Weight | 308.80 |
| CAS Registry Number | 6493-69-2 |
| SMILES | C(C(O)(C([O-])=O)CC(=O)O)C([O-])=O.[Sn++] |
| InChI | 1S/C6H8O7.Sn/c7-3(8)1-6(13,5(11)12)2-4(9)10;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);/q;+2/p-2 |
| InChIKey | USYAMXSCYLGBPT-UHFFFAOYSA-L |
| Boiling point | 309.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 155.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Stannic citrate |