|
CAS#: 64942-50-3 Product: 1-Ethyl L-2-Aminoglutarate Hydrochloride No suppilers available for the product. |
| Name | 1-Ethyl L-2-Aminoglutarate Hydrochloride |
|---|---|
| Synonyms | 4-Amino-5-Ethoxy-5-Oxo-Pentanoic Acid Hydrochloride; 4-Amino-5-Ethoxy-5-Keto-Valeric Acid Hydrochloride; 1-Ethyl L-2-Aminoglutarate Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C7H14ClNO4 |
| Molecular Weight | 211.64 |
| CAS Registry Number | 64942-50-3 |
| EINECS | 265-286-3 |
| SMILES | [H+].C(C(N)C(OCC)=O)CC(O)=O.[Cl-] |
| InChI | 1S/C7H13NO4.ClH/c1-2-12-7(11)5(8)3-4-6(9)10;/h5H,2-4,8H2,1H3,(H,9,10);1H |
| InChIKey | LPZDSTWSQMZTOR-UHFFFAOYSA-N |
| Boiling point | 315°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 144.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Ethyl L-2-Aminoglutarate Hydrochloride |