|
CAS#: 64965-01-1 Product: 2-(Diethylamino)-4H-1-Benzopyran-4-One No suppilers available for the product. |
| Name | 2-(Diethylamino)-4H-1-Benzopyran-4-One |
|---|---|
| Synonyms | 2-Diethylamino-4-Chromenone; 2-Diethylaminochromone; 2-Dietilamminocromone [Italian] |
| Molecular Structure | ![]() |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 |
| CAS Registry Number | 64965-01-1 |
| SMILES | C1=C2C(=CC=C1)C(C=C(O2)N(CC)CC)=O |
| InChI | 1S/C13H15NO2/c1-3-14(4-2)13-9-11(15)10-7-5-6-8-12(10)16-13/h5-9H,3-4H2,1-2H3 |
| InChIKey | YROQGDCTFDQWPP-UHFFFAOYSA-N |
| Density | 1.15g/cm3 (Cal.) |
|---|---|
| Boiling point | 309.189°C at 760 mmHg (Cal.) |
| Flash point | 140.793°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Diethylamino)-4H-1-Benzopyran-4-One |