|
CAS#: 65021-26-3 Product: 7-Chloro-3,3-Dimethylindan-5-Ol No suppilers available for the product. |
| Name | 7-Chloro-3,3-Dimethylindan-5-Ol |
|---|---|
| Synonyms | 7-Chloro-3,3-Dimethyl-Indan-5-Ol; 7-Chloro-3,3-Dimethyl-5-Indanol |
| Molecular Structure | ![]() |
| Molecular Formula | C11H13ClO |
| Molecular Weight | 196.68 |
| CAS Registry Number | 65021-26-3 |
| EINECS | 265-312-3 |
| SMILES | C2=C(Cl)C1=C(C(CC1)(C)C)C=C2O |
| InChI | 1S/C11H13ClO/c1-11(2)4-3-8-9(11)5-7(13)6-10(8)12/h5-6,13H,3-4H2,1-2H3 |
| InChIKey | XDXVRAOZMUSNFK-UHFFFAOYSA-N |
| Density | 1.175g/cm3 (Cal.) |
|---|---|
| Boiling point | 297.209°C at 760 mmHg (Cal.) |
| Flash point | 133.547°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Chloro-3,3-Dimethylindan-5-Ol |