|
CAS#: 6539-57-7 Product: 2-Amino-1-(3,4-Dihydroxyphenyl)Propan-1-Ol No suppilers available for the product. |
| Name | 2-Amino-1-(3,4-Dihydroxyphenyl)Propan-1-Ol |
|---|---|
| Synonyms | 4-(2-Amino-1-Hydroxy-Propyl)Benzene-1,2-Diol Hydrochloride; 4-(2-Amino-1-Hydroxy-Propyl)Pyrocatechol Hydrochloride; Ncgc00095315-01 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H14ClNO3 |
| Molecular Weight | 219.67 |
| CAS Registry Number | 6539-57-7 (138-61-4) |
| EINECS | 229-452-9 |
| SMILES | [H+].C1=C(C(O)C(N)C)C=CC(=C1O)O.[Cl-] |
| InChI | 1S/C9H13NO3.ClH/c1-5(10)9(13)6-2-3-7(11)8(12)4-6;/h2-5,9,11-13H,10H2,1H3;1H |
| InChIKey | YRJLEOWRVNBAOI-UHFFFAOYSA-N |
| Boiling point | 431.6°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 214.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Amino-1-(3,4-Dihydroxyphenyl)Propan-1-Ol |