|
CAS#: 65416-23-1 Product: 3-Methylpent-3-Enyl Phenylacetate No suppilers available for the product. |
| Name | 3-Methylpent-3-Enyl Phenylacetate |
|---|---|
| Synonyms | 2-Phenylacetic Acid [(E)-3-Methylpent-3-Enyl] Ester; [(E)-3-Methylpent-3-Enyl] 2-Phenylethanoate; 3-Methylpent-3-Enyl Phenylacetate |
| Molecular Structure | ![]() |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 |
| CAS Registry Number | 65416-23-1 |
| EINECS | 265-763-6 |
| SMILES | C1=C(CC(OCC\C(=C\C)C)=O)C=CC=C1 |
| InChI | 1S/C14H18O2/c1-3-12(2)9-10-16-14(15)11-13-7-5-4-6-8-13/h3-8H,9-11H2,1-2H3/b12-3+ |
| InChIKey | ZSWBBBXEPCSQNE-KGVSQERTSA-N |
| Density | 1g/cm3 (Cal.) |
|---|---|
| Boiling point | 308.658°C at 760 mmHg (Cal.) |
| Flash point | 118.919°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methylpent-3-Enyl Phenylacetate |