Online Database of Chemicals from Around the World
|
CAS#: 65437-70-9 Product: Octahydro-1,5,5,8alpha-Tetramethyl-1,4-Methanoazulen-7-(1H)-One No suppilers available for the product. |
| Name | Octahydro-1,5,5,8alpha-Tetramethyl-1,4-Methanoazulen-7-(1H)-One |
|---|---|
| Synonyms | 2,2,6,10-Tetramethyltricyclo(5.4.0.06,10)Undecan-4-One; Octahydro-1,5,5,8A-Tetramethyl-1,4-Methanoazulen-7-(1H)-One |
| Molecular Structure |  |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.35 |
| CAS Registry Number | 65437-70-9 |
| EINECS | 265-776-7 |
| SMILES | CC13C2(CC(C1CC2)C(CC(=O)C3)(C)C)C |
| InChI | 1S/C15H24O/c1-13(2)7-10(16)8-15(4)11-5-6-14(15,3)9-12(11)13/h11-12H,5-9H2,1-4H3 |
| InChIKey | BMLTXHGGEJNZIS-UHFFFAOYSA-N |
| Density | 0.994g/cm3 (Cal.) |
|---|---|
| Boiling point | 286.752°C at 760 mmHg (Cal.) |
| Flash point | 119.694°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Octahydro-1,5,5,8alpha-Tetramethyl-1,4-Methanoazulen-7-(1H)-One |